C21H18O2 — CID 56612001
(4S,5S)-3-methyl-1,2,4,5-tetrahydrobenzo[j]aceanthrylene-4,5-diol (PubChem CID 56612001) has the molecular formula C21H18O2 and a molecular weight of 302.37 g/mol. Its IUPAC name is (4S,5S)-3-methyl-1,2,4,5-tetrahydrobenzo[j]aceanthrylene-4,5-diol.
| Compound Name | (4S,5S)-3-methyl-1,2,4,5-tetrahydrobenzo[j]aceanthrylene-4,5-diol |
|---|---|
| PubChem CID | 56612001 |
| Molecular Formula | C21H18O2 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | (4S,5S)-3-methyl-1,2,4,5-tetrahydrobenzo[j]aceanthrylene-4,5-diol |
| SMILES | CC1=C2CCc3c2c(cc2c3ccc3ccccc32)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H18O2/c1-11-13-8-9-16-15-7-6-12-4-2-3-5-14(12)17(15)10-18(19(13)16)21(23)20(11)22/h2-7,10,20-23H,8-9H2,1H3/t20-,21-/m0/s1 |
| InChIKey | FTCYTLPWERPCGJ-SFTDATJTSA-N |
| XLogP | 4.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|