C20H18O2 — CID 54071625
(8S,9S)-7,12-dimethyl-8,9-dihydrobenzo[a]anthracene-8,9-diol (PubChem CID 54071625) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is (8S,9S)-7,12-dimethyl-8,9-dihydrobenzo[a]anthracene-8,9-diol.
| Compound Name | (8S,9S)-7,12-dimethyl-8,9-dihydrobenzo[a]anthracene-8,9-diol |
|---|---|
| PubChem CID | 54071625 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | (8S,9S)-7,12-dimethyl-8,9-dihydrobenzo[a]anthracene-8,9-diol |
| SMILES | Cc1c2c(c(C)c3c1ccc1ccccc13)C=C[C@H](O)[C@H]2O |
| InChI | InChI=1S/C20H18O2/c1-11-15-9-10-17(21)20(22)19(15)12(2)14-8-7-13-5-3-4-6-16(13)18(11)14/h3-10,17,20-22H,1-2H3/t17-,20+/m0/s1 |
| InChIKey | MGVSNRUTBCLGBA-FXAWDEMLSA-N |
| XLogP | 4.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|