C20H13FO2 — CID 10780808
(7S,8S)-6-fluoro-7,8-dihydrobenzo[a]pyrene-7,8-diol (PubChem CID 10780808) has the molecular formula C20H13FO2 and a molecular weight of 304.32 g/mol. Its IUPAC name is (7S,8S)-6-fluoro-7,8-dihydrobenzo[a]pyrene-7,8-diol.
| Compound Name | (7S,8S)-6-fluoro-7,8-dihydrobenzo[a]pyrene-7,8-diol |
|---|---|
| PubChem CID | 10780808 |
| Molecular Formula | C20H13FO2 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (7S,8S)-6-fluoro-7,8-dihydrobenzo[a]pyrene-7,8-diol |
| SMILES | O[C@H]1C=Cc2c(c(F)c3ccc4cccc5ccc2c3c45)[C@@H]1O |
| InChI | InChI=1S/C20H13FO2/c21-19-14-7-5-11-3-1-2-10-4-6-12(17(14)16(10)11)13-8-9-15(22)20(23)18(13)19/h1-9,15,20,22-23H/t15-,20+/m0/s1 |
| InChIKey | KBGUEKKHFJQKTP-MGPUTAFESA-N |
| XLogP | 4.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|