About 1,4-dioxane;phenanthren-1-ylmethanol
1,4-dioxane;phenanthren-1-ylmethanol (PubChem CID 174807196) has the molecular formula C19H20O3
and a molecular weight of 296.37 g/mol. Its IUPAC name is 1,4-dioxane;phenanthren-1-ylmethanol.
Molecular Properties
| Compound Name | 1,4-dioxane;phenanthren-1-ylmethanol |
| PubChem CID | 174807196 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 1,4-dioxane;phenanthren-1-ylmethanol |
| SMILES | C1COCCO1.OCc1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C15H12O.C4H8O2/c16-10-12-5-3-7-15-13-6-2-1-4-11(13)8-9-14(12)15;1-2-6-4-3-5-1/h1-9,16H,10H2;1-4H2 |
| InChIKey | GCZNUVQJAKWIDV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dioxane;phenanthren-1-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxane;phenanthren-1-ylmethanol?
The IUPAC name of 1,4-dioxane;phenanthren-1-ylmethanol (CID 174807196) is 1,4-dioxane;phenanthren-1-ylmethanol.
What is the SMILES notation for 1,4-dioxane;phenanthren-1-ylmethanol?
The canonical SMILES for 1,4-dioxane;phenanthren-1-ylmethanol is C1COCCO1.OCc1cccc2c1ccc1ccccc12.
What is the InChIKey of 1,4-dioxane;phenanthren-1-ylmethanol?
The InChIKey is GCZNUVQJAKWIDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O.C4H8O2/c16-10-12-5-3-7-15-13-6-2-1-4-11(13)8-9-14(12)15;1-2-6-4-3-5-1/h1-9,16H,10H2;1-4H2.
What are the key properties of 1,4-dioxane;phenanthren-1-ylmethanol?
1,4-dioxane;phenanthren-1-ylmethanol has a molecular weight of 296.37 g/mol, XLogP of 3.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxane;phenanthren-1-ylmethanol is sourced from PubChem (CID 174807196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).