About bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+)
bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+) (PubChem CID 139141064) has the molecular formula C32H44CrN2Si4
and a molecular weight of 621.06 g/mol. Its IUPAC name is bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+).
Molecular Properties
| Compound Name | bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+) |
| PubChem CID | 139141064 |
| Molecular Formula | C32H44CrN2Si4 |
| Molecular Weight | 621.06 g/mol |
| Exact Mass | 620.20 |
| IUPAC Name | bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+) |
| SMILES | C[Si](C)([N-][Si](C)(C)c1ccccc1)c1ccccc1.C[Si](C)([N-][Si](C)(C)c1ccccc1)c1ccccc1.[Cr+2] |
| InChI | InChI=1S/2C16H22NSi2.Cr/c2*1-18(2,15-11-7-5-8-12-15)17-19(3,4)16-13-9-6-10-14-16;/h2*5-14H,1-4H3;/q2*-1;+2 |
| InChIKey | YZRGUQMUXSTUDX-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 28.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 621.06 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+)?
The IUPAC name of bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+) (CID 139141064) is bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+).
What is the SMILES notation for bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+)?
The canonical SMILES for bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+) is C[Si](C)([N-][Si](C)(C)c1ccccc1)c1ccccc1.C[Si](C)([N-][Si](C)(C)c1ccccc1)c1ccccc1.[Cr+2].
What is the InChIKey of bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+)?
The InChIKey is YZRGUQMUXSTUDX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H22NSi2.Cr/c2*1-18(2,15-11-7-5-8-12-15)17-19(3,4)16-13-9-6-10-14-16;/h2*5-14H,1-4H3;/q2*-1;+2.
What are the key properties of bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+)?
bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+) has a molecular weight of 621.06 g/mol, XLogP of 7.17, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis[dimethyl(phenyl)silyl]azanide);chromium(2+) is sourced from PubChem (CID 139141064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).