C40H30Zr — CID 172693912
bis(1-cyclopenta-1,3-dien-1-yl-2-phenyl-1H-indene);zirconium(2+) (PubChem CID 172693912) has the molecular formula C40H30Zr and a molecular weight of 601.90 g/mol. Its IUPAC name is bis(1-cyclopenta-1,3-dien-1-yl-2-phenyl-1H-indene);zirconium(2+).
| Compound Name | bis(1-cyclopenta-1,3-dien-1-yl-2-phenyl-1H-indene);zirconium(2+) |
|---|---|
| PubChem CID | 172693912 |
| Molecular Formula | C40H30Zr |
| Molecular Weight | 601.90 g/mol |
| Exact Mass | 600.14 |
| IUPAC Name | bis(1-cyclopenta-1,3-dien-1-yl-2-phenyl-1H-indene);zirconium(2+) |
| SMILES | C1=C(c2ccccc2)C(c2ccc[cH-]2)c2ccccc21.C1=C(c2ccccc2)C(c2ccc[cH-]2)c2ccccc21.[Zr+2] |
| InChI | InChI=1S/2C20H15.Zr/c2*1-2-8-15(9-3-1)19-14-17-12-6-7-13-18(17)20(19)16-10-4-5-11-16;/h2*1-14,20H;/q2*-1;+2 |
| InChIKey | CBEHGUYYSBPOGL-UHFFFAOYSA-N |
| XLogP | 10.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.90 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|