C28H31N — CID 23014756
2-methyl-N-[2-[2-(2-phenyl-1H-inden-1-yl)phenyl]propan-2-yl]propan-2-amine (PubChem CID 23014756) has the molecular formula C28H31N and a molecular weight of 381.56 g/mol. Its IUPAC name is 2-methyl-N-[2-[2-(2-phenyl-1H-inden-1-yl)phenyl]propan-2-yl]propan-2-amine.
| Compound Name | 2-methyl-N-[2-[2-(2-phenyl-1H-inden-1-yl)phenyl]propan-2-yl]propan-2-amine |
|---|---|
| PubChem CID | 23014756 |
| Molecular Formula | C28H31N |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | 2-methyl-N-[2-[2-(2-phenyl-1H-inden-1-yl)phenyl]propan-2-yl]propan-2-amine |
| SMILES | CC(C)(C)NC(C)(C)c1ccccc1C1C(c2ccccc2)=Cc2ccccc21 |
| InChI | InChI=1S/C28H31N/c1-27(2,3)29-28(4,5)25-18-12-11-17-23(25)26-22-16-10-9-15-21(22)19-24(26)20-13-7-6-8-14-20/h6-19,26,29H,1-5H3 |
| InChIKey | ALSUDDHUKGZKLK-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|