About 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde
3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde (PubChem CID 141067337) has the molecular formula C16H12O
and a molecular weight of 220.27 g/mol. Its IUPAC name is 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde.
Molecular Properties
| Compound Name | 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde |
| PubChem CID | 141067337 |
| Molecular Formula | C16H12O |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde |
| SMILES | O=Cc1cc2ccccc2cc1C1C=CC=C1 |
| InChI | InChI=1S/C16H12O/c17-11-15-9-13-7-3-4-8-14(13)10-16(15)12-5-1-2-6-12/h1-12H |
| InChIKey | ZCRDJDBLGCEXJU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde?
The IUPAC name of 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde (CID 141067337) is 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde.
What is the SMILES notation for 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde?
The canonical SMILES for 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde is O=Cc1cc2ccccc2cc1C1C=CC=C1.
What is the InChIKey of 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde?
The InChIKey is ZCRDJDBLGCEXJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12O/c17-11-15-9-13-7-3-4-8-14(13)10-16(15)12-5-1-2-6-12/h1-12H.
What are the key properties of 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde?
3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde has a molecular weight of 220.27 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-2,4-dien-1-ylnaphthalene-2-carbaldehyde is sourced from PubChem (CID 141067337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).