C17H14N- — CID 12826867
N-cyclopenta-1,3-dien-1-yl-N-phenylaniline (PubChem CID 12826867) has the molecular formula C17H14N- and a molecular weight of 232.31 g/mol. Its IUPAC name is N-cyclopenta-1,3-dien-1-yl-N-phenylaniline.
| Compound Name | N-cyclopenta-1,3-dien-1-yl-N-phenylaniline |
|---|---|
| PubChem CID | 12826867 |
| Molecular Formula | C17H14N- |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | N-cyclopenta-1,3-dien-1-yl-N-phenylaniline |
| SMILES | c1ccc(N(c2ccccc2)c2ccc[cH-]2)cc1 |
| InChI | InChI=1S/C17H14N/c1-3-9-15(10-4-1)18(17-13-7-8-14-17)16-11-5-2-6-12-16/h1-14H/q-1 |
| InChIKey | JAQHXHZUNBNYDM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|