C20H16Fe2I2 — CID 136948957
5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;bis(1-iodocyclopenta-1,3-diene);bis(iron(2+)) (PubChem CID 136948957) has the molecular formula C20H16Fe2I2 and a molecular weight of 621.85 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;bis(1-iodocyclopenta-1,3-diene);bis(iron(2+)).
| Compound Name | 5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;bis(1-iodocyclopenta-1,3-diene);bis(iron(2+)) |
|---|---|
| PubChem CID | 136948957 |
| Molecular Formula | C20H16Fe2I2 |
| Molecular Weight | 621.85 g/mol |
| Exact Mass | 621.80 |
| IUPAC Name | 5-cyclopenta-2,4-dien-1-ylcyclopenta-1,3-diene;bis(1-iodocyclopenta-1,3-diene);bis(iron(2+)) |
| SMILES | Ic1ccc[cH-]1.Ic1ccc[cH-]1.[Fe+2].[Fe+2].c1cc[c-](-[c-]2cccc2)c1 |
| InChI | InChI=1S/C10H8.2C5H4I.2Fe/c1-2-6-9(5-1)10-7-3-4-8-10;2*6-5-3-1-2-4-5;;/h1-8H;2*1-4H;;/q-2;2*-1;2*+2 |
| InChIKey | DZYPVORTMZIHET-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.85 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|