C44H60P2 — CID 90110960
1-bis(2,3,4-trimethylphenyl)phosphanyloctyl-bis(2,3,4-trimethylphenyl)phosphane (PubChem CID 90110960) has the molecular formula C44H60P2 and a molecular weight of 650.91 g/mol. Its IUPAC name is 1-bis(2,3,4-trimethylphenyl)phosphanyloctyl-bis(2,3,4-trimethylphenyl)phosphane.
| Compound Name | 1-bis(2,3,4-trimethylphenyl)phosphanyloctyl-bis(2,3,4-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 90110960 |
| Molecular Formula | C44H60P2 |
| Molecular Weight | 650.91 g/mol |
| Exact Mass | 650.42 |
| IUPAC Name | 1-bis(2,3,4-trimethylphenyl)phosphanyloctyl-bis(2,3,4-trimethylphenyl)phosphane |
| SMILES | CCCCCCCC(P(c1ccc(C)c(C)c1C)c1ccc(C)c(C)c1C)P(c1ccc(C)c(C)c1C)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C44H60P2/c1-14-15-16-17-18-19-44(45(40-24-20-28(2)32(6)36(40)10)41-25-21-29(3)33(7)37(41)11)46(42-26-22-30(4)34(8)38(42)12)43-27-23-31(5)35(9)39(43)13/h20-27,44H,14-19H2,1-13H3 |
| InChIKey | LMCQPPAETWNUGC-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.91 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|