C38H48P2 — CID 90109151
1-bis(2,3-dimethylphenyl)phosphanylhexyl-bis(2,3-dimethylphenyl)phosphane (PubChem CID 90109151) has the molecular formula C38H48P2 and a molecular weight of 566.75 g/mol. Its IUPAC name is 1-bis(2,3-dimethylphenyl)phosphanylhexyl-bis(2,3-dimethylphenyl)phosphane.
| Compound Name | 1-bis(2,3-dimethylphenyl)phosphanylhexyl-bis(2,3-dimethylphenyl)phosphane |
|---|---|
| PubChem CID | 90109151 |
| Molecular Formula | C38H48P2 |
| Molecular Weight | 566.75 g/mol |
| Exact Mass | 566.32 |
| IUPAC Name | 1-bis(2,3-dimethylphenyl)phosphanylhexyl-bis(2,3-dimethylphenyl)phosphane |
| SMILES | CCCCCC(P(c1cccc(C)c1C)c1cccc(C)c1C)P(c1cccc(C)c1C)c1cccc(C)c1C |
| InChI | InChI=1S/C38H48P2/c1-10-11-12-25-38(39(34-21-13-17-26(2)30(34)6)35-22-14-18-27(3)31(35)7)40(36-23-15-19-28(4)32(36)8)37-24-16-20-29(5)33(37)9/h13-24,38H,10-12,25H2,1-9H3 |
| InChIKey | FRGRJNYIOAAIGU-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.75 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|