C12H17- — CID 91264011
1,2,3-trimethyl-4-propan-2-ylbenzene (PubChem CID 91264011) has the molecular formula C12H17- and a molecular weight of 161.27 g/mol. Its IUPAC name is 1,2,3-trimethyl-4-propan-2-ylbenzene.
| Compound Name | 1,2,3-trimethyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 91264011 |
| Molecular Formula | C12H17- |
| Molecular Weight | 161.27 g/mol |
| Exact Mass | 161.13 |
| IUPAC Name | 1,2,3-trimethyl-4-propan-2-ylbenzene |
| SMILES | Cc1ccc([C-](C)C)c(C)c1C |
| InChI | InChI=1S/C12H17/c1-8(2)12-7-6-9(3)10(4)11(12)5/h6-7H,1-5H3/q-1 |
| InChIKey | URSKGUXLGOJIDQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.27 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|