C12H17N — CID 20769409
N-(2,3,4-trimethylphenyl)propan-2-imine (PubChem CID 20769409) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is N-(2,3,4-trimethylphenyl)propan-2-imine.
| Compound Name | N-(2,3,4-trimethylphenyl)propan-2-imine |
|---|---|
| PubChem CID | 20769409 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | N-(2,3,4-trimethylphenyl)propan-2-imine |
| SMILES | CC(C)=Nc1ccc(C)c(C)c1C |
| InChI | InChI=1S/C12H17N/c1-8(2)13-12-7-6-9(3)10(4)11(12)5/h6-7H,1-5H3 |
| InChIKey | KAVPXQADWILDIW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|