C18H22OS2 — CID 174547072
1,2,3-trimethyl-4-(2,3,4-trimethylphenyl)sulfanyloxysulfanylbenzene (PubChem CID 174547072) has the molecular formula C18H22OS2 and a molecular weight of 318.51 g/mol. Its IUPAC name is 1,2,3-trimethyl-4-(2,3,4-trimethylphenyl)sulfanyloxysulfanylbenzene.
| Compound Name | 1,2,3-trimethyl-4-(2,3,4-trimethylphenyl)sulfanyloxysulfanylbenzene |
|---|---|
| PubChem CID | 174547072 |
| Molecular Formula | C18H22OS2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | 1,2,3-trimethyl-4-(2,3,4-trimethylphenyl)sulfanyloxysulfanylbenzene |
| SMILES | Cc1ccc(SOSc2ccc(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C18H22OS2/c1-11-7-9-17(15(5)13(11)3)20-19-21-18-10-8-12(2)14(4)16(18)6/h7-10H,1-6H3 |
| InChIKey | KATCNFKTCOXLHC-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|