C9H12AcN- — CID 22888997
actinium;(2,3,6-trimethylphenyl)azanide (PubChem CID 22888997) has the molecular formula C9H12AcN- and a molecular weight of 361.20 g/mol. Its IUPAC name is actinium;(2,3,6-trimethylphenyl)azanide.
| Compound Name | actinium;(2,3,6-trimethylphenyl)azanide |
|---|---|
| PubChem CID | 22888997 |
| Molecular Formula | C9H12AcN- |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | actinium;(2,3,6-trimethylphenyl)azanide |
| SMILES | Cc1ccc(C)c([NH-])c1C.[Ac] |
| InChI | InChI=1S/C9H12N.Ac/c1-6-4-5-7(2)9(10)8(6)3;/h4-5,10H,1-3H3;/q-1; |
| InChIKey | NWWMLDXWYXBBKJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |