About magnesium;(2,6-dimethylphenyl)azanide;bromide
magnesium;(2,6-dimethylphenyl)azanide;bromide (PubChem CID 12799521) has the molecular formula C8H10BrMgN
and a molecular weight of 224.38 g/mol. Its IUPAC name is magnesium;(2,6-dimethylphenyl)azanide;bromide.
Molecular Properties
| Compound Name | magnesium;(2,6-dimethylphenyl)azanide;bromide |
| PubChem CID | 12799521 |
| Molecular Formula | C8H10BrMgN |
| Molecular Weight | 224.38 g/mol |
| Exact Mass | 222.98 |
| IUPAC Name | magnesium;(2,6-dimethylphenyl)azanide;bromide |
| SMILES | Cc1cccc(C)c1[NH-].[Br-].[Mg+2] |
| InChI | InChI=1S/C8H10N.BrH.Mg/c1-6-4-3-5-7(2)8(6)9;;/h3-5,9H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | WONCFSCNLVTZKJ-UHFFFAOYSA-M |
| XLogP | -0.39 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.38 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze magnesium;(2,6-dimethylphenyl)azanide;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;(2,6-dimethylphenyl)azanide;bromide?
The IUPAC name of magnesium;(2,6-dimethylphenyl)azanide;bromide (CID 12799521) is magnesium;(2,6-dimethylphenyl)azanide;bromide.
What is the SMILES notation for magnesium;(2,6-dimethylphenyl)azanide;bromide?
The canonical SMILES for magnesium;(2,6-dimethylphenyl)azanide;bromide is Cc1cccc(C)c1[NH-].[Br-].[Mg+2].
What is the InChIKey of magnesium;(2,6-dimethylphenyl)azanide;bromide?
The InChIKey is WONCFSCNLVTZKJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H10N.BrH.Mg/c1-6-4-3-5-7(2)8(6)9;;/h3-5,9H,1-2H3;1H;/q-1;;+2/p-1.
What are the key properties of magnesium;(2,6-dimethylphenyl)azanide;bromide?
magnesium;(2,6-dimethylphenyl)azanide;bromide has a molecular weight of 224.38 g/mol, XLogP of -0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;(2,6-dimethylphenyl)azanide;bromide is sourced from PubChem (CID 12799521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).