C10H17NO — CID 145309295
2-amino-3,4-dimethylphenol;ethane (PubChem CID 145309295) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-amino-3,4-dimethylphenol;ethane.
| Compound Name | 2-amino-3,4-dimethylphenol;ethane |
|---|---|
| PubChem CID | 145309295 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-amino-3,4-dimethylphenol;ethane |
| SMILES | CC.Cc1ccc(O)c(N)c1C |
| InChI | InChI=1S/C8H11NO.C2H6/c1-5-3-4-7(10)8(9)6(5)2;1-2/h3-4,10H,9H2,1-2H3;1-2H3 |
| InChIKey | KEFWNNLYWDJQJA-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|