C17H24N2O4 — CID 174523614
2-amino-5,6-dimethoxy-3-methylphenol;2-amino-3,4-dimethylphenol (PubChem CID 174523614) has the molecular formula C17H24N2O4 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-amino-5,6-dimethoxy-3-methylphenol;2-amino-3,4-dimethylphenol.
| Compound Name | 2-amino-5,6-dimethoxy-3-methylphenol;2-amino-3,4-dimethylphenol |
|---|---|
| PubChem CID | 174523614 |
| Molecular Formula | C17H24N2O4 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-amino-5,6-dimethoxy-3-methylphenol;2-amino-3,4-dimethylphenol |
| SMILES | COc1cc(C)c(N)c(O)c1OC.Cc1ccc(O)c(N)c1C |
| InChI | InChI=1S/C9H13NO3.C8H11NO/c1-5-4-6(12-2)9(13-3)8(11)7(5)10;1-5-3-4-7(10)8(9)6(5)2/h4,11H,10H2,1-3H3;3-4,10H,9H2,1-2H3 |
| InChIKey | KXYWMMXHGSLLDZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|