C15H12Br2ClFO2 — CID 63432255
1-bromo-2-[(3-bromo-5-fluorophenyl)-chloromethyl]-4,5-dimethoxybenzene (PubChem CID 63432255) has the molecular formula C15H12Br2ClFO2 and a molecular weight of 438.52 g/mol. Its IUPAC name is 1-bromo-2-[(3-bromo-5-fluorophenyl)-chloromethyl]-4,5-dimethoxybenzene.
| Compound Name | 1-bromo-2-[(3-bromo-5-fluorophenyl)-chloromethyl]-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 63432255 |
| Molecular Formula | C15H12Br2ClFO2 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 435.89 |
| IUPAC Name | 1-bromo-2-[(3-bromo-5-fluorophenyl)-chloromethyl]-4,5-dimethoxybenzene |
| SMILES | COc1cc(Br)c(C(Cl)c2cc(F)cc(Br)c2)cc1OC |
| InChI | InChI=1S/C15H12Br2ClFO2/c1-20-13-6-11(12(17)7-14(13)21-2)15(18)8-3-9(16)5-10(19)4-8/h3-7,15H,1-2H3 |
| InChIKey | BLKRLXHKDNKOBY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|