C13H18Br2O — CID 114875970
1-(2,5-dibromo-4-methylphenyl)-3-methylpentan-1-ol (PubChem CID 114875970) has the molecular formula C13H18Br2O and a molecular weight of 350.09 g/mol. Its IUPAC name is 1-(2,5-dibromo-4-methylphenyl)-3-methylpentan-1-ol.
| Compound Name | 1-(2,5-dibromo-4-methylphenyl)-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 114875970 |
| Molecular Formula | C13H18Br2O |
| Molecular Weight | 350.09 g/mol |
| Exact Mass | 347.97 |
| IUPAC Name | 1-(2,5-dibromo-4-methylphenyl)-3-methylpentan-1-ol |
| SMILES | CCC(C)CC(O)c1cc(Br)c(C)cc1Br |
| InChI | InChI=1S/C13H18Br2O/c1-4-8(2)5-13(16)10-7-11(14)9(3)6-12(10)15/h6-8,13,16H,4-5H2,1-3H3 |
| InChIKey | BTKOEYNPQRICJZ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.09 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |