C12H20OS — CID 114875969
1-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-ol (PubChem CID 114875969) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is 1-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-ol.
| Compound Name | 1-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 114875969 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | 1-(3,5-dimethylthiophen-2-yl)-3-methylpentan-1-ol |
| SMILES | CCC(C)CC(O)c1sc(C)cc1C |
| InChI | InChI=1S/C12H20OS/c1-5-8(2)6-11(13)12-9(3)7-10(4)14-12/h7-8,11,13H,5-6H2,1-4H3 |
| InChIKey | BTIXNGIXNCNMDE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |