C9H14OS — CID 81157083
1-(3,5-dimethylthiophen-2-yl)propan-1-ol (PubChem CID 81157083) has the molecular formula C9H14OS and a molecular weight of 170.28 g/mol. Its IUPAC name is 1-(3,5-dimethylthiophen-2-yl)propan-1-ol.
| Compound Name | 1-(3,5-dimethylthiophen-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 81157083 |
| Molecular Formula | C9H14OS |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1-(3,5-dimethylthiophen-2-yl)propan-1-ol |
| SMILES | CCC(O)c1sc(C)cc1C |
| InChI | InChI=1S/C9H14OS/c1-4-8(10)9-6(2)5-7(3)11-9/h5,8,10H,4H2,1-3H3 |
| InChIKey | KOGMYJVZLHWEGJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |