C11H16O2S — CID 81157613
(3,5-dimethylthiophen-2-yl)-(oxolan-3-yl)methanol (PubChem CID 81157613) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is (3,5-dimethylthiophen-2-yl)-(oxolan-3-yl)methanol.
| Compound Name | (3,5-dimethylthiophen-2-yl)-(oxolan-3-yl)methanol |
|---|---|
| PubChem CID | 81157613 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | (3,5-dimethylthiophen-2-yl)-(oxolan-3-yl)methanol |
| SMILES | Cc1cc(C)c(C(O)C2CCOC2)s1 |
| InChI | InChI=1S/C11H16O2S/c1-7-5-8(2)14-11(7)10(12)9-3-4-13-6-9/h5,9-10,12H,3-4,6H2,1-2H3 |
| InChIKey | RLGTZMLFAKSSNV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |