C10H14O3 — CID 104789574
(2-methylfuran-3-yl)-(oxolan-3-yl)methanol (PubChem CID 104789574) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (2-methylfuran-3-yl)-(oxolan-3-yl)methanol.
| Compound Name | (2-methylfuran-3-yl)-(oxolan-3-yl)methanol |
|---|---|
| PubChem CID | 104789574 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2-methylfuran-3-yl)-(oxolan-3-yl)methanol |
| SMILES | Cc1occc1C(O)C1CCOC1 |
| InChI | InChI=1S/C10H14O3/c1-7-9(3-5-13-7)10(11)8-2-4-12-6-8/h3,5,8,10-11H,2,4,6H2,1H3 |
| InChIKey | NKYRQPKUPBSJFI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |