C12H15BrO3 — CID 61277701
(2-bromo-4-methoxyphenyl)-(oxolan-3-yl)methanol (PubChem CID 61277701) has the molecular formula C12H15BrO3 and a molecular weight of 287.15 g/mol. Its IUPAC name is (2-bromo-4-methoxyphenyl)-(oxolan-3-yl)methanol.
| Compound Name | (2-bromo-4-methoxyphenyl)-(oxolan-3-yl)methanol |
|---|---|
| PubChem CID | 61277701 |
| Molecular Formula | C12H15BrO3 |
| Molecular Weight | 287.15 g/mol |
| Exact Mass | 286.02 |
| IUPAC Name | (2-bromo-4-methoxyphenyl)-(oxolan-3-yl)methanol |
| SMILES | COc1ccc(C(O)C2CCOC2)c(Br)c1 |
| InChI | InChI=1S/C12H15BrO3/c1-15-9-2-3-10(11(13)6-9)12(14)8-4-5-16-7-8/h2-3,6,8,12,14H,4-5,7H2,1H3 |
| InChIKey | WFXFMHPXUBJYGQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.15 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |