C14H21BrO — CID 114875950
1-(4-bromo-2,5-dimethylphenyl)-3-methylpentan-1-ol (PubChem CID 114875950) has the molecular formula C14H21BrO and a molecular weight of 285.23 g/mol. Its IUPAC name is 1-(4-bromo-2,5-dimethylphenyl)-3-methylpentan-1-ol.
| Compound Name | 1-(4-bromo-2,5-dimethylphenyl)-3-methylpentan-1-ol |
|---|---|
| PubChem CID | 114875950 |
| Molecular Formula | C14H21BrO |
| Molecular Weight | 285.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(4-bromo-2,5-dimethylphenyl)-3-methylpentan-1-ol |
| SMILES | CCC(C)CC(O)c1cc(C)c(Br)cc1C |
| InChI | InChI=1S/C14H21BrO/c1-5-9(2)6-14(16)12-7-11(4)13(15)8-10(12)3/h7-9,14,16H,5-6H2,1-4H3 |
| InChIKey | VSVLZMQZNDIDNV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.23 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |