C15H23BrO2 — CID 83921965
6-(2-bromo-4,5-dimethylphenyl)heptane-3,4-diol (PubChem CID 83921965) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is 6-(2-bromo-4,5-dimethylphenyl)heptane-3,4-diol.
| Compound Name | 6-(2-bromo-4,5-dimethylphenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83921965 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-(2-bromo-4,5-dimethylphenyl)heptane-3,4-diol |
| SMILES | CCC(O)C(O)CC(C)c1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C15H23BrO2/c1-5-14(17)15(18)8-11(4)12-6-9(2)10(3)7-13(12)16/h6-7,11,14-15,17-18H,5,8H2,1-4H3 |
| InChIKey | UQIVHLPVNOTHRW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |