C14H17Br — CID 83921906
1-bromo-2-hex-4-yn-2-yl-4,5-dimethylbenzene (PubChem CID 83921906) has the molecular formula C14H17Br and a molecular weight of 265.19 g/mol. Its IUPAC name is 1-bromo-2-hex-4-yn-2-yl-4,5-dimethylbenzene.
| Compound Name | 1-bromo-2-hex-4-yn-2-yl-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 83921906 |
| Molecular Formula | C14H17Br |
| Molecular Weight | 265.19 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 1-bromo-2-hex-4-yn-2-yl-4,5-dimethylbenzene |
| SMILES | CC#CCC(C)c1cc(C)c(C)cc1Br |
| InChI | InChI=1S/C14H17Br/c1-5-6-7-10(2)13-8-11(3)12(4)9-14(13)15/h8-10H,7H2,1-4H3 |
| InChIKey | VLEGGCKAWIVIKI-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.19 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|