C16H22O — CID 83942081
2-ethoxy-1-hex-4-yn-2-yl-3,5-dimethylbenzene (PubChem CID 83942081) has the molecular formula C16H22O and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-ethoxy-1-hex-4-yn-2-yl-3,5-dimethylbenzene.
| Compound Name | 2-ethoxy-1-hex-4-yn-2-yl-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 83942081 |
| Molecular Formula | C16H22O |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-ethoxy-1-hex-4-yn-2-yl-3,5-dimethylbenzene |
| SMILES | CC#CCC(C)c1cc(C)cc(C)c1OCC |
| InChI | InChI=1S/C16H22O/c1-6-8-9-13(4)15-11-12(3)10-14(5)16(15)17-7-2/h10-11,13H,7,9H2,1-5H3 |
| InChIKey | VZYGRXARXWMDQE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|