C15H14BrClO — CID 139494105
(2-bromo-4,5-dimethylphenyl)-(4-chlorophenyl)methanol (PubChem CID 139494105) has the molecular formula C15H14BrClO and a molecular weight of 325.63 g/mol. Its IUPAC name is (2-bromo-4,5-dimethylphenyl)-(4-chlorophenyl)methanol.
| Compound Name | (2-bromo-4,5-dimethylphenyl)-(4-chlorophenyl)methanol |
|---|---|
| PubChem CID | 139494105 |
| Molecular Formula | C15H14BrClO |
| Molecular Weight | 325.63 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (2-bromo-4,5-dimethylphenyl)-(4-chlorophenyl)methanol |
| SMILES | Cc1cc(Br)c(C(O)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C15H14BrClO/c1-9-7-13(14(16)8-10(9)2)15(18)11-3-5-12(17)6-4-11/h3-8,15,18H,1-2H3 |
| InChIKey | UUMGHTNJHRJJSK-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.63 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |