C14H10Br2Cl2O — CID 81472697
(2,5-dibromo-4-methylphenyl)-(2,5-dichlorophenyl)methanol (PubChem CID 81472697) has the molecular formula C14H10Br2Cl2O and a molecular weight of 424.95 g/mol. Its IUPAC name is (2,5-dibromo-4-methylphenyl)-(2,5-dichlorophenyl)methanol.
| Compound Name | (2,5-dibromo-4-methylphenyl)-(2,5-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 81472697 |
| Molecular Formula | C14H10Br2Cl2O |
| Molecular Weight | 424.95 g/mol |
| Exact Mass | 421.85 |
| IUPAC Name | (2,5-dibromo-4-methylphenyl)-(2,5-dichlorophenyl)methanol |
| SMILES | Cc1cc(Br)c(C(O)c2cc(Cl)ccc2Cl)cc1Br |
| InChI | InChI=1S/C14H10Br2Cl2O/c1-7-4-12(16)9(6-11(7)15)14(19)10-5-8(17)2-3-13(10)18/h2-6,14,19H,1H3 |
| InChIKey | OEEVLVPTARBEKT-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.95 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |