C19H33NO2 — CID 83934656
2-(aminomethyl)-4-[4-(2-methylpropoxy)-3-propan-2-ylphenyl]pentan-1-ol (PubChem CID 83934656) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 2-(aminomethyl)-4-[4-(2-methylpropoxy)-3-propan-2-ylphenyl]pentan-1-ol.
| Compound Name | 2-(aminomethyl)-4-[4-(2-methylpropoxy)-3-propan-2-ylphenyl]pentan-1-ol |
|---|---|
| PubChem CID | 83934656 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 2-(aminomethyl)-4-[4-(2-methylpropoxy)-3-propan-2-ylphenyl]pentan-1-ol |
| SMILES | CC(C)COc1ccc(C(C)CC(CN)CO)cc1C(C)C |
| InChI | InChI=1S/C19H33NO2/c1-13(2)12-22-19-7-6-17(9-18(19)14(3)4)15(5)8-16(10-20)11-21/h6-7,9,13-16,21H,8,10-12,20H2,1-5H3 |
| InChIKey | RJVNPFCRAWVNER-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |