C8H10BrNO3 — CID 117372646
3-(1-amino-2-hydroxyethyl)-6-bromobenzene-1,2-diol (PubChem CID 117372646) has the molecular formula C8H10BrNO3 and a molecular weight of 248.08 g/mol. Its IUPAC name is 3-(1-amino-2-hydroxyethyl)-6-bromobenzene-1,2-diol.
| Compound Name | 3-(1-amino-2-hydroxyethyl)-6-bromobenzene-1,2-diol |
|---|---|
| PubChem CID | 117372646 |
| Molecular Formula | C8H10BrNO3 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 3-(1-amino-2-hydroxyethyl)-6-bromobenzene-1,2-diol |
| SMILES | NC(CO)c1ccc(Br)c(O)c1O |
| InChI | InChI=1S/C8H10BrNO3/c9-5-2-1-4(6(10)3-11)7(12)8(5)13/h1-2,6,11-13H,3,10H2 |
| InChIKey | UGRJBHKVAKIVFW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|