C14H19FN2O3 — CID 171268416
(1R,2S)-2-amino-1-cyclohexyl-2-(4-fluoro-2-nitrophenyl)ethanol (PubChem CID 171268416) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is (1R,2S)-2-amino-1-cyclohexyl-2-(4-fluoro-2-nitrophenyl)ethanol.
| Compound Name | (1R,2S)-2-amino-1-cyclohexyl-2-(4-fluoro-2-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 171268416 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (1R,2S)-2-amino-1-cyclohexyl-2-(4-fluoro-2-nitrophenyl)ethanol |
| SMILES | N[C@@H](c1ccc(F)cc1[N+](=O)[O-])[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H19FN2O3/c15-10-6-7-11(12(8-10)17(19)20)13(16)14(18)9-4-2-1-3-5-9/h6-9,13-14,18H,1-5,16H2/t13-,14+/m0/s1 |
| InChIKey | IHUIZJVSUUJFCK-UONOGXRCSA-N |
| XLogP | 2.67 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|