C11H15FN2O3 — CID 171262745
(1R,2S)-1-amino-1-(4-fluoro-2-nitrophenyl)-3-methylbutan-2-ol (PubChem CID 171262745) has the molecular formula C11H15FN2O3 and a molecular weight of 242.25 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(4-fluoro-2-nitrophenyl)-3-methylbutan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(4-fluoro-2-nitrophenyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 171262745 |
| Molecular Formula | C11H15FN2O3 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (1R,2S)-1-amino-1-(4-fluoro-2-nitrophenyl)-3-methylbutan-2-ol |
| SMILES | CC(C)[C@H](O)[C@H](N)c1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15FN2O3/c1-6(2)11(15)10(13)8-4-3-7(12)5-9(8)14(16)17/h3-6,10-11,15H,13H2,1-2H3/t10-,11+/m1/s1 |
| InChIKey | MJKWEBRDMHAYJX-MNOVXSKESA-N |
| XLogP | 1.75 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|