C10H13F2NO — CID 84776170
2-amino-2-(3,5-difluoro-2,4-dimethylphenyl)ethanol (PubChem CID 84776170) has the molecular formula C10H13F2NO and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-amino-2-(3,5-difluoro-2,4-dimethylphenyl)ethanol.
| Compound Name | 2-amino-2-(3,5-difluoro-2,4-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 84776170 |
| Molecular Formula | C10H13F2NO |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.10 |
| IUPAC Name | 2-amino-2-(3,5-difluoro-2,4-dimethylphenyl)ethanol |
| SMILES | Cc1c(F)cc(C(N)CO)c(C)c1F |
| InChI | InChI=1S/C10H13F2NO/c1-5-7(9(13)4-14)3-8(11)6(2)10(5)12/h3,9,14H,4,13H2,1-2H3 |
| InChIKey | ARGWNCNMENYZGE-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |