C11H16FNO — CID 84774435
3-amino-3-(3-fluoro-2,5-dimethylphenyl)propan-1-ol (PubChem CID 84774435) has the molecular formula C11H16FNO and a molecular weight of 197.25 g/mol. Its IUPAC name is 3-amino-3-(3-fluoro-2,5-dimethylphenyl)propan-1-ol.
| Compound Name | 3-amino-3-(3-fluoro-2,5-dimethylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 84774435 |
| Molecular Formula | C11H16FNO |
| Molecular Weight | 197.25 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 3-amino-3-(3-fluoro-2,5-dimethylphenyl)propan-1-ol |
| SMILES | Cc1cc(F)c(C)c(C(N)CCO)c1 |
| InChI | InChI=1S/C11H16FNO/c1-7-5-9(11(13)3-4-14)8(2)10(12)6-7/h5-6,11,14H,3-4,13H2,1-2H3 |
| InChIKey | FYIJSFGSYISAGO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |