C9H10FNO4 — CID 66514552
5-[(1S)-1-amino-2-hydroxyethyl]-2-fluoro-4-hydroxybenzoic acid (PubChem CID 66514552) has the molecular formula C9H10FNO4 and a molecular weight of 215.18 g/mol. Its IUPAC name is 5-[(1S)-1-amino-2-hydroxyethyl]-2-fluoro-4-hydroxybenzoic acid.
| Compound Name | 5-[(1S)-1-amino-2-hydroxyethyl]-2-fluoro-4-hydroxybenzoic acid |
|---|---|
| PubChem CID | 66514552 |
| Molecular Formula | C9H10FNO4 |
| Molecular Weight | 215.18 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 5-[(1S)-1-amino-2-hydroxyethyl]-2-fluoro-4-hydroxybenzoic acid |
| SMILES | N[C@H](CO)c1cc(C(=O)O)c(F)cc1O |
| InChI | InChI=1S/C9H10FNO4/c10-6-2-8(13)5(7(11)3-12)1-4(6)9(14)15/h1-2,7,12-13H,3,11H2,(H,14,15)/t7-/m1/s1 |
| InChIKey | GRWMBBYSHQALHU-SSDOTTSWSA-N |
| XLogP | 0.22 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|