C14H18BrClO3 — CID 63386249
2-bromo-1-(2-chloro-4,5-diethoxyphenyl)butan-1-one (PubChem CID 63386249) has the molecular formula C14H18BrClO3 and a molecular weight of 349.65 g/mol. Its IUPAC name is 2-bromo-1-(2-chloro-4,5-diethoxyphenyl)butan-1-one.
| Compound Name | 2-bromo-1-(2-chloro-4,5-diethoxyphenyl)butan-1-one |
|---|---|
| PubChem CID | 63386249 |
| Molecular Formula | C14H18BrClO3 |
| Molecular Weight | 349.65 g/mol |
| Exact Mass | 348.01 |
| IUPAC Name | 2-bromo-1-(2-chloro-4,5-diethoxyphenyl)butan-1-one |
| SMILES | CCOc1cc(Cl)c(C(=O)C(Br)CC)cc1OCC |
| InChI | InChI=1S/C14H18BrClO3/c1-4-10(15)14(17)9-7-12(18-5-2)13(19-6-3)8-11(9)16/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | VDYSMNSZBUALLE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.65 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|