C9H11N3O — CID 163440212
1-[4,5-diamino-2-(methylideneamino)phenyl]ethanone (PubChem CID 163440212) has the molecular formula C9H11N3O and a molecular weight of 177.21 g/mol. Its IUPAC name is 1-[4,5-diamino-2-(methylideneamino)phenyl]ethanone.
| Compound Name | 1-[4,5-diamino-2-(methylideneamino)phenyl]ethanone |
|---|---|
| PubChem CID | 163440212 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 1-[4,5-diamino-2-(methylideneamino)phenyl]ethanone |
| SMILES | C=Nc1cc(N)c(N)cc1C(C)=O |
| InChI | InChI=1S/C9H11N3O/c1-5(13)6-3-7(10)8(11)4-9(6)12-2/h3-4H,2,10-11H2,1H3 |
| InChIKey | AXWSATHYRBHXAR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|