C9H12N2O2S — CID 82673739
2-amino-4,5-dimethoxybenzenecarbothioamide (PubChem CID 82673739) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxybenzenecarbothioamide.
| Compound Name | 2-amino-4,5-dimethoxybenzenecarbothioamide |
|---|---|
| PubChem CID | 82673739 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 2-amino-4,5-dimethoxybenzenecarbothioamide |
| SMILES | COc1cc(N)c(C(N)=S)cc1OC |
| InChI | InChI=1S/C9H12N2O2S/c1-12-7-3-5(9(11)14)6(10)4-8(7)13-2/h3-4H,10H2,1-2H3,(H2,11,14) |
| InChIKey | MMFBQWVQXDCWDY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|