C18H24N4O3 — CID 109125715
N-butyl-6-(2,5-dimethoxyanilino)-N-methylpyridazine-3-carboxamide (PubChem CID 109125715) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is N-butyl-6-(2,5-dimethoxyanilino)-N-methylpyridazine-3-carboxamide.
| Compound Name | N-butyl-6-(2,5-dimethoxyanilino)-N-methylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109125715 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-butyl-6-(2,5-dimethoxyanilino)-N-methylpyridazine-3-carboxamide |
| SMILES | CCCCN(C)C(=O)c1ccc(Nc2cc(OC)ccc2OC)nn1 |
| InChI | InChI=1S/C18H24N4O3/c1-5-6-11-22(2)18(23)14-8-10-17(21-20-14)19-15-12-13(24-3)7-9-16(15)25-4/h7-10,12H,5-6,11H2,1-4H3,(H,19,21) |
| InChIKey | DTLJUPFYVMWIHD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |