C17H22N4O3 — CID 109124457
6-(2,5-dimethoxyanilino)-N,N-diethylpyridazine-3-carboxamide (PubChem CID 109124457) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 6-(2,5-dimethoxyanilino)-N,N-diethylpyridazine-3-carboxamide.
| Compound Name | 6-(2,5-dimethoxyanilino)-N,N-diethylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 109124457 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 6-(2,5-dimethoxyanilino)-N,N-diethylpyridazine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1ccc(Nc2cc(OC)ccc2OC)nn1 |
| InChI | InChI=1S/C17H22N4O3/c1-5-21(6-2)17(22)13-8-10-16(20-19-13)18-14-11-12(23-3)7-9-15(14)24-4/h7-11H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | OGKCXZAAPDNVCO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |