C20H25NO4S — CID 31795650
N-[2-(3,5-dimethylphenoxy)ethyl]-2-ethylsulfonyl-N-methylbenzamide (PubChem CID 31795650) has the molecular formula C20H25NO4S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-2-ethylsulfonyl-N-methylbenzamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-ethylsulfonyl-N-methylbenzamide |
|---|---|
| PubChem CID | 31795650 |
| Molecular Formula | C20H25NO4S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-2-ethylsulfonyl-N-methylbenzamide |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)N(C)CCOc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C20H25NO4S/c1-5-26(23,24)19-9-7-6-8-18(19)20(22)21(4)10-11-25-17-13-15(2)12-16(3)14-17/h6-9,12-14H,5,10-11H2,1-4H3 |
| InChIKey | ZSLCKWIXQSUWTQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |