C21H22N2O2 — CID 18119687
N-[2-(3,5-dimethylphenoxy)ethyl]-N-methylquinoline-8-carboxamide (PubChem CID 18119687) has the molecular formula C21H22N2O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N-[2-(3,5-dimethylphenoxy)ethyl]-N-methylquinoline-8-carboxamide.
| Compound Name | N-[2-(3,5-dimethylphenoxy)ethyl]-N-methylquinoline-8-carboxamide |
|---|---|
| PubChem CID | 18119687 |
| Molecular Formula | C21H22N2O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-[2-(3,5-dimethylphenoxy)ethyl]-N-methylquinoline-8-carboxamide |
| SMILES | Cc1cc(C)cc(OCCN(C)C(=O)c2cccc3cccnc23)c1 |
| InChI | InChI=1S/C21H22N2O2/c1-15-12-16(2)14-18(13-15)25-11-10-23(3)21(24)19-8-4-6-17-7-5-9-22-20(17)19/h4-9,12-14H,10-11H2,1-3H3 |
| InChIKey | KSYRJVLVUSQPBA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |