About N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide
N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide (PubChem CID 131951452) has the molecular formula C23H30N2O3
and a molecular weight of 382.50 g/mol. Its IUPAC name is N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide.
Molecular Properties
| Compound Name | N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide |
| PubChem CID | 131951452 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide |
| SMILES | Cc1cc(C)cc(OCCCN(C)C(=O)c2ccccc2N2CCOCC2)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-18-15-19(2)17-20(16-18)28-12-6-9-24(3)23(26)21-7-4-5-8-22(21)25-10-13-27-14-11-25/h4-5,7-8,15-17H,6,9-14H2,1-3H3 |
| InChIKey | KWAFKOQFANHNBV-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide?
The IUPAC name of N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide (CID 131951452) is N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide.
What is the SMILES notation for N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide?
The canonical SMILES for N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide is Cc1cc(C)cc(OCCCN(C)C(=O)c2ccccc2N2CCOCC2)c1.
What is the InChIKey of N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide?
The InChIKey is KWAFKOQFANHNBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O3/c1-18-15-19(2)17-20(16-18)28-12-6-9-24(3)23(26)21-7-4-5-8-22(21)25-10-13-27-14-11-25/h4-5,7-8,15-17H,6,9-14H2,1-3H3.
What are the key properties of N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide?
N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide has a molecular weight of 382.50 g/mol, XLogP of 3.68, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(3,5-dimethylphenoxy)propyl]-N-methyl-2-morpholin-4-ylbenzamide is sourced from PubChem (CID 131951452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).