About 2-ethylsulfonylbenzoyl chloride
2-ethylsulfonylbenzoyl chloride (PubChem CID 18978016) has the molecular formula C9H9ClO3S
and a molecular weight of 232.69 g/mol. Its IUPAC name is 2-ethylsulfonylbenzoyl chloride.
Molecular Properties
| Compound Name | 2-ethylsulfonylbenzoyl chloride |
| PubChem CID | 18978016 |
| Molecular Formula | C9H9ClO3S |
| Molecular Weight | 232.69 g/mol |
| Exact Mass | 232.00 |
| IUPAC Name | 2-ethylsulfonylbenzoyl chloride |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)Cl |
| InChI | InChI=1S/C9H9ClO3S/c1-2-14(12,13)8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3 |
| InChIKey | RAZSFYCXYAZINF-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.69 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylsulfonylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonylbenzoyl chloride?
The IUPAC name of 2-ethylsulfonylbenzoyl chloride (CID 18978016) is 2-ethylsulfonylbenzoyl chloride.
What is the SMILES notation for 2-ethylsulfonylbenzoyl chloride?
The canonical SMILES for 2-ethylsulfonylbenzoyl chloride is CCS(=O)(=O)c1ccccc1C(=O)Cl.
What is the InChIKey of 2-ethylsulfonylbenzoyl chloride?
The InChIKey is RAZSFYCXYAZINF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9ClO3S/c1-2-14(12,13)8-6-4-3-5-7(8)9(10)11/h3-6H,2H2,1H3.
What are the key properties of 2-ethylsulfonylbenzoyl chloride?
2-ethylsulfonylbenzoyl chloride has a molecular weight of 232.69 g/mol, XLogP of 1.86, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonylbenzoyl chloride is sourced from PubChem (CID 18978016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).