C19H27N5O3S — CID 100640927
N-butyl-N-methyl-2-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]sulfamoyl]benzamide (PubChem CID 100640927) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-butyl-N-methyl-2-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]sulfamoyl]benzamide.
| Compound Name | N-butyl-N-methyl-2-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 100640927 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-butyl-N-methyl-2-[[(8R)-2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-yl]sulfamoyl]benzamide |
| SMILES | CCCCN(C)C(=O)c1ccccc1S(=O)(=O)N[C@@H]1CCCn2nc(C)nc21 |
| InChI | InChI=1S/C19H27N5O3S/c1-4-5-12-23(3)19(25)15-9-6-7-11-17(15)28(26,27)22-16-10-8-13-24-18(16)20-14(2)21-24/h6-7,9,11,16,22H,4-5,8,10,12-13H2,1-3H3/t16-/m1/s1 |
| InChIKey | DCAFQSICUMNLDH-MRXNPFEDSA-N |
| XLogP | 2.27 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |