C11H16N6O3S — CID 79529175
4-[(5-amino-1-methylpyrazol-4-yl)methylsulfamoyl]-1-methylpyrrole-2-carboxamide (PubChem CID 79529175) has the molecular formula C11H16N6O3S and a molecular weight of 312.36 g/mol. Its IUPAC name is 4-[(5-amino-1-methylpyrazol-4-yl)methylsulfamoyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | 4-[(5-amino-1-methylpyrazol-4-yl)methylsulfamoyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79529175 |
| Molecular Formula | C11H16N6O3S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | 4-[(5-amino-1-methylpyrazol-4-yl)methylsulfamoyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)NCc2cnn(C)c2N)cc1C(N)=O |
| InChI | InChI=1S/C11H16N6O3S/c1-16-6-8(3-9(16)11(13)18)21(19,20)15-5-7-4-14-17(2)10(7)12/h3-4,6,15H,5,12H2,1-2H3,(H2,13,18) |
| InChIKey | ZAEMRAYOBXJDIV-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 138.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |